L-Alanine, N-(3-chloro-4-fluorophenyl)-
CAS No: 62766-92-1
Alanine
62766-92-1
alanine,chloro,fluorophenyl,62766-92-1
2025-10-21 Discover L-Alanine, N-(3-chloro-4-fluorophenyl)- (CAS No: 62766-92-1) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.